C9H12BrClFNO2S — CID 171245711
ethyl (3R)-3-amino-3-(4-bromothiophen-2-yl)-2-fluoropropanoate;hydrochloride (PubChem CID 171245711) has the molecular formula C9H12BrClFNO2S and a molecular weight of 332.62 g/mol. Its IUPAC name is ethyl (3R)-3-amino-3-(4-bromothiophen-2-yl)-2-fluoropropanoate;hydrochloride.
| Compound Name | ethyl (3R)-3-amino-3-(4-bromothiophen-2-yl)-2-fluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171245711 |
| Molecular Formula | C9H12BrClFNO2S |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 330.94 |
| IUPAC Name | ethyl (3R)-3-amino-3-(4-bromothiophen-2-yl)-2-fluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1cc(Br)cs1.Cl |
| InChI | InChI=1S/C9H11BrFNO2S.ClH/c1-2-14-9(13)7(11)8(12)6-3-5(10)4-15-6;/h3-4,7-8H,2,12H2,1H3;1H/t7?,8-;/m0./s1 |
| InChIKey | PNAFMYUDSYFFGR-MTICXXPYSA-N |
| XLogP | 2.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |