C11H13Br2ClFNO3 — CID 171256673
ethyl (3S)-3-amino-3-(3,6-dibromo-2-hydroxyphenyl)-2-fluoropropanoate;hydrochloride (PubChem CID 171256673) has the molecular formula C11H13Br2ClFNO3 and a molecular weight of 421.49 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-(3,6-dibromo-2-hydroxyphenyl)-2-fluoropropanoate;hydrochloride.
| Compound Name | ethyl (3S)-3-amino-3-(3,6-dibromo-2-hydroxyphenyl)-2-fluoropropanoate;hydrochloride |
|---|---|
| PubChem CID | 171256673 |
| Molecular Formula | C11H13Br2ClFNO3 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 418.89 |
| IUPAC Name | ethyl (3S)-3-amino-3-(3,6-dibromo-2-hydroxyphenyl)-2-fluoropropanoate;hydrochloride |
| SMILES | CCOC(=O)C(F)[C@@H](N)c1c(Br)ccc(Br)c1O.Cl |
| InChI | InChI=1S/C11H12Br2FNO3.ClH/c1-2-18-11(17)8(14)9(15)7-5(12)3-4-6(13)10(7)16;/h3-4,8-9,16H,2,15H2,1H3;1H/t8?,9-;/m0./s1 |
| InChIKey | WKQCZTLORQRNEJ-MTFPJWTKSA-N |
| XLogP | 3.24 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|