C12H15F2NO3 — CID 171253983
ethyl (3R)-3-amino-2-fluoro-3-(6-fluoro-2-hydroxy-3-methylphenyl)propanoate (PubChem CID 171253983) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is ethyl (3R)-3-amino-2-fluoro-3-(6-fluoro-2-hydroxy-3-methylphenyl)propanoate.
| Compound Name | ethyl (3R)-3-amino-2-fluoro-3-(6-fluoro-2-hydroxy-3-methylphenyl)propanoate |
|---|---|
| PubChem CID | 171253983 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | ethyl (3R)-3-amino-2-fluoro-3-(6-fluoro-2-hydroxy-3-methylphenyl)propanoate |
| SMILES | CCOC(=O)C(F)[C@H](N)c1c(F)ccc(C)c1O |
| InChI | InChI=1S/C12H15F2NO3/c1-3-18-12(17)9(14)10(15)8-7(13)5-4-6(2)11(8)16/h4-5,9-10,16H,3,15H2,1-2H3/t9?,10-/m1/s1 |
| InChIKey | XJXWPOSYVADDAJ-QVDQXJPCSA-N |
| XLogP | 1.74 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|