C9H10FNO3 — CID 66510686
(2S)-2-amino-2-(6-fluoro-2-hydroxy-3-methylphenyl)acetic acid (PubChem CID 66510686) has the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. Its IUPAC name is (2S)-2-amino-2-(6-fluoro-2-hydroxy-3-methylphenyl)acetic acid.
| Compound Name | (2S)-2-amino-2-(6-fluoro-2-hydroxy-3-methylphenyl)acetic acid |
|---|---|
| PubChem CID | 66510686 |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | (2S)-2-amino-2-(6-fluoro-2-hydroxy-3-methylphenyl)acetic acid |
| SMILES | Cc1ccc(F)c([C@H](N)C(=O)O)c1O |
| InChI | InChI=1S/C9H10FNO3/c1-4-2-3-5(10)6(8(4)12)7(11)9(13)14/h2-3,7,12H,11H2,1H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | JCJSOKOTCHSXAN-ZETCQYMHSA-N |
| XLogP | 0.92 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|