C10H12F2N2O2 — CID 117115111
2-amino-2-[2-(dimethylamino)-3,6-difluorophenyl]acetic acid (PubChem CID 117115111) has the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. Its IUPAC name is 2-amino-2-[2-(dimethylamino)-3,6-difluorophenyl]acetic acid.
| Compound Name | 2-amino-2-[2-(dimethylamino)-3,6-difluorophenyl]acetic acid |
|---|---|
| PubChem CID | 117115111 |
| Molecular Formula | C10H12F2N2O2 |
| Molecular Weight | 230.21 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-amino-2-[2-(dimethylamino)-3,6-difluorophenyl]acetic acid |
| SMILES | CN(C)c1c(F)ccc(F)c1C(N)C(=O)O |
| InChI | InChI=1S/C10H12F2N2O2/c1-14(2)9-6(12)4-3-5(11)7(9)8(13)10(15)16/h3-4,8H,13H2,1-2H3,(H,15,16) |
| InChIKey | ALZKQIZKUHLSBB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |