C9H9F2NO2S — CID 117337661
2-amino-2-(2,6-difluoro-3-methylsulfanylphenyl)acetic acid (PubChem CID 117337661) has the molecular formula C9H9F2NO2S and a molecular weight of 233.24 g/mol. Its IUPAC name is 2-amino-2-(2,6-difluoro-3-methylsulfanylphenyl)acetic acid.
| Compound Name | 2-amino-2-(2,6-difluoro-3-methylsulfanylphenyl)acetic acid |
|---|---|
| PubChem CID | 117337661 |
| Molecular Formula | C9H9F2NO2S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 2-amino-2-(2,6-difluoro-3-methylsulfanylphenyl)acetic acid |
| SMILES | CSc1ccc(F)c(C(N)C(=O)O)c1F |
| InChI | InChI=1S/C9H9F2NO2S/c1-15-5-3-2-4(10)6(7(5)11)8(12)9(13)14/h2-3,8H,12H2,1H3,(H,13,14) |
| InChIKey | VMMGWPDOUBHUPK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |