C10H10F2O2S — CID 117336107
2-(2,6-difluoro-3-methylsulfanylphenyl)propanoic acid (PubChem CID 117336107) has the molecular formula C10H10F2O2S and a molecular weight of 232.25 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-methylsulfanylphenyl)propanoic acid.
| Compound Name | 2-(2,6-difluoro-3-methylsulfanylphenyl)propanoic acid |
|---|---|
| PubChem CID | 117336107 |
| Molecular Formula | C10H10F2O2S |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2-(2,6-difluoro-3-methylsulfanylphenyl)propanoic acid |
| SMILES | CSc1ccc(F)c(C(C)C(=O)O)c1F |
| InChI | InChI=1S/C10H10F2O2S/c1-5(10(13)14)8-6(11)3-4-7(15-2)9(8)12/h3-5H,1-2H3,(H,13,14) |
| InChIKey | MIZSKVOSYQGPEU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |