2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid

C11H13FO4 — CID 117328473

IUPAC2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid
SMILESCOc1ccc(F)c(C(C)C(=O)O)c1OC
InChIInChI=1S/C11H13FO4/c1-6(11(13)14)9-7(12)4-5-8(15-2)10(9)16-3/h4-6H,1-3H3,(H,13,14)
InChIKeyXGTFJJUPKGAQHK-UHFFFAOYSA-N
MW228.22 g/mol
LogP2.03
Rot. Bonds4

About 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid

2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid (PubChem CID 117328473) has the molecular formula C11H13FO4 and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid.

Molecular Properties

Compound Name2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid
PubChem CID117328473
Molecular FormulaC11H13FO4
Molecular Weight228.22 g/mol
Exact Mass228.08
IUPAC Name2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid
SMILESCOc1ccc(F)c(C(C)C(=O)O)c1OC
InChIInChI=1S/C11H13FO4/c1-6(11(13)14)9-7(12)4-5-8(15-2)10(9)16-3/h4-6H,1-3H3,(H,13,14)
InChIKeyXGTFJJUPKGAQHK-UHFFFAOYSA-N
XLogP2.03
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.22
LogP ≤ 52.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid?
The IUPAC name of 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid (CID 117328473) is 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid.
What is the SMILES notation for 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid?
The canonical SMILES for 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid is COc1ccc(F)c(C(C)C(=O)O)c1OC.
What is the InChIKey of 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid?
The InChIKey is XGTFJJUPKGAQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FO4/c1-6(11(13)14)9-7(12)4-5-8(15-2)10(9)16-3/h4-6H,1-3H3,(H,13,14).
What are the key properties of 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid?
2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid has a molecular weight of 228.22 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-2,3-dimethoxyphenyl)propanoic acid is sourced from PubChem (CID 117328473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).