C9H10ClNO2S — CID 84695213
2-amino-2-(5-chloro-2-methylsulfanylphenyl)acetic acid (PubChem CID 84695213) has the molecular formula C9H10ClNO2S and a molecular weight of 231.70 g/mol. Its IUPAC name is 2-amino-2-(5-chloro-2-methylsulfanylphenyl)acetic acid.
| Compound Name | 2-amino-2-(5-chloro-2-methylsulfanylphenyl)acetic acid |
|---|---|
| PubChem CID | 84695213 |
| Molecular Formula | C9H10ClNO2S |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | 2-amino-2-(5-chloro-2-methylsulfanylphenyl)acetic acid |
| SMILES | CSc1ccc(Cl)cc1C(N)C(=O)O |
| InChI | InChI=1S/C9H10ClNO2S/c1-14-7-3-2-5(10)4-6(7)8(11)9(12)13/h2-4,8H,11H2,1H3,(H,12,13) |
| InChIKey | UCBPWHWTZCAKNX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |