C10H8F2N2O2 — CID 117324730
2-amino-2-(5,7-difluoro-1H-indol-6-yl)acetic acid (PubChem CID 117324730) has the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. Its IUPAC name is 2-amino-2-(5,7-difluoro-1H-indol-6-yl)acetic acid.
| Compound Name | 2-amino-2-(5,7-difluoro-1H-indol-6-yl)acetic acid |
|---|---|
| PubChem CID | 117324730 |
| Molecular Formula | C10H8F2N2O2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-amino-2-(5,7-difluoro-1H-indol-6-yl)acetic acid |
| SMILES | NC(C(=O)O)c1c(F)cc2cc[nH]c2c1F |
| InChI | InChI=1S/C10H8F2N2O2/c11-5-3-4-1-2-14-9(4)7(12)6(5)8(13)10(15)16/h1-3,8,14H,13H2,(H,15,16) |
| InChIKey | BEKHLVKPVLNNCP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |