C10H9F2NO — CID 117286630
1-(5,7-difluoro-1H-indol-6-yl)ethanol (PubChem CID 117286630) has the molecular formula C10H9F2NO and a molecular weight of 197.18 g/mol. Its IUPAC name is 1-(5,7-difluoro-1H-indol-6-yl)ethanol.
| Compound Name | 1-(5,7-difluoro-1H-indol-6-yl)ethanol |
|---|---|
| PubChem CID | 117286630 |
| Molecular Formula | C10H9F2NO |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 1-(5,7-difluoro-1H-indol-6-yl)ethanol |
| SMILES | CC(O)c1c(F)cc2cc[nH]c2c1F |
| InChI | InChI=1S/C10H9F2NO/c1-5(14)8-7(11)4-6-2-3-13-10(6)9(8)12/h2-5,13-14H,1H3 |
| InChIKey | QGHGFBUORJZRHJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |