3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid

C11H10F2N2O2 — CID 117352563

IUPAC3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid
SMILESNCC(C(=O)O)c1c(F)cc2cc[nH]c2c1F
InChIInChI=1S/C11H10F2N2O2/c12-7-3-5-1-2-15-10(5)9(13)8(7)6(4-14)11(16)17/h1-3,6,15H,4,14H2,(H,16,17)
InChIKeyKYLMWLZPQUCJOM-UHFFFAOYSA-N
MW240.21 g/mol
LogP1.57
Rot. Bonds3

About 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid

3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid (PubChem CID 117352563) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid.

Molecular Properties

Compound Name3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid
PubChem CID117352563
Molecular FormulaC11H10F2N2O2
Molecular Weight240.21 g/mol
Exact Mass240.07
IUPAC Name3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid
SMILESNCC(C(=O)O)c1c(F)cc2cc[nH]c2c1F
InChIInChI=1S/C11H10F2N2O2/c12-7-3-5-1-2-15-10(5)9(13)8(7)6(4-14)11(16)17/h1-3,6,15H,4,14H2,(H,16,17)
InChIKeyKYLMWLZPQUCJOM-UHFFFAOYSA-N
XLogP1.57
TPSA79.11 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.21
LogP ≤ 51.57
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid?
The IUPAC name of 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid (CID 117352563) is 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid.
What is the SMILES notation for 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid?
The canonical SMILES for 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid is NCC(C(=O)O)c1c(F)cc2cc[nH]c2c1F.
What is the InChIKey of 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid?
The InChIKey is KYLMWLZPQUCJOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N2O2/c12-7-3-5-1-2-15-10(5)9(13)8(7)6(4-14)11(16)17/h1-3,6,15H,4,14H2,(H,16,17).
What are the key properties of 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid?
3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid has a molecular weight of 240.21 g/mol, XLogP of 1.57, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(5,7-difluoro-1H-indol-6-yl)propanoic acid is sourced from PubChem (CID 117352563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).