3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid

C11H9F2NO3 — CID 117354378

IUPAC3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid
SMILESNCC(C(=O)O)c1c(F)cc(F)c2ccoc12
InChIInChI=1S/C11H9F2NO3/c12-7-3-8(13)9(6(4-14)11(15)16)10-5(7)1-2-17-10/h1-3,6H,4,14H2,(H,15,16)
InChIKeyXNERUQDSDQPGDS-UHFFFAOYSA-N
MW241.19 g/mol
LogP1.84
Rot. Bonds3

About 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid

3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid (PubChem CID 117354378) has the molecular formula C11H9F2NO3 and a molecular weight of 241.19 g/mol. Its IUPAC name is 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid.

Molecular Properties

Compound Name3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid
PubChem CID117354378
Molecular FormulaC11H9F2NO3
Molecular Weight241.19 g/mol
Exact Mass241.06
IUPAC Name3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid
SMILESNCC(C(=O)O)c1c(F)cc(F)c2ccoc12
InChIInChI=1S/C11H9F2NO3/c12-7-3-8(13)9(6(4-14)11(15)16)10-5(7)1-2-17-10/h1-3,6H,4,14H2,(H,15,16)
InChIKeyXNERUQDSDQPGDS-UHFFFAOYSA-N
XLogP1.84
TPSA76.46 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.19
LogP ≤ 51.84
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid?
The IUPAC name of 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid (CID 117354378) is 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid.
What is the SMILES notation for 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid?
The canonical SMILES for 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid is NCC(C(=O)O)c1c(F)cc(F)c2ccoc12.
What is the InChIKey of 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid?
The InChIKey is XNERUQDSDQPGDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F2NO3/c12-7-3-8(13)9(6(4-14)11(15)16)10-5(7)1-2-17-10/h1-3,6H,4,14H2,(H,15,16).
What are the key properties of 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid?
3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid has a molecular weight of 241.19 g/mol, XLogP of 1.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(4,6-difluoro-1-benzofuran-7-yl)propanoic acid is sourced from PubChem (CID 117354378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).