C12H13F2NO — CID 117322960
3-(5,7-difluoro-1-benzofuran-4-yl)butan-1-amine (PubChem CID 117322960) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is 3-(5,7-difluoro-1-benzofuran-4-yl)butan-1-amine.
| Compound Name | 3-(5,7-difluoro-1-benzofuran-4-yl)butan-1-amine |
|---|---|
| PubChem CID | 117322960 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-(5,7-difluoro-1-benzofuran-4-yl)butan-1-amine |
| SMILES | CC(CCN)c1c(F)cc(F)c2occc12 |
| InChI | InChI=1S/C12H13F2NO/c1-7(2-4-15)11-8-3-5-16-12(8)10(14)6-9(11)13/h3,5-7H,2,4,15H2,1H3 |
| InChIKey | JLBCLFOFHHKDHE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |