C11H11F2NO2 — CID 117326258
1-(5,7-difluoro-1-benzofuran-4-yl)-2-(methylamino)ethanol (PubChem CID 117326258) has the molecular formula C11H11F2NO2 and a molecular weight of 227.21 g/mol. Its IUPAC name is 1-(5,7-difluoro-1-benzofuran-4-yl)-2-(methylamino)ethanol.
| Compound Name | 1-(5,7-difluoro-1-benzofuran-4-yl)-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 117326258 |
| Molecular Formula | C11H11F2NO2 |
| Molecular Weight | 227.21 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 1-(5,7-difluoro-1-benzofuran-4-yl)-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1c(F)cc(F)c2occc12 |
| InChI | InChI=1S/C11H11F2NO2/c1-14-5-9(15)10-6-2-3-16-11(6)8(13)4-7(10)12/h2-4,9,14-15H,5H2,1H3 |
| InChIKey | PXPFYCKZWHBRFC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |