C12H10F2O4 — CID 117393392
ethyl 2-(5,7-difluoro-1-benzofuran-4-yl)-2-hydroxyacetate (PubChem CID 117393392) has the molecular formula C12H10F2O4 and a molecular weight of 256.20 g/mol. Its IUPAC name is ethyl 2-(5,7-difluoro-1-benzofuran-4-yl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(5,7-difluoro-1-benzofuran-4-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117393392 |
| Molecular Formula | C12H10F2O4 |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | ethyl 2-(5,7-difluoro-1-benzofuran-4-yl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1c(F)cc(F)c2occc12 |
| InChI | InChI=1S/C12H10F2O4/c1-2-17-12(16)10(15)9-6-3-4-18-11(6)8(14)5-7(9)13/h3-5,10,15H,2H2,1H3 |
| InChIKey | CBUJCGGBXDXSBZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |