C14H15NO2 — CID 117330543
2-(8-methylfuro[2,3-f][1]benzofuran-4-yl)propan-1-amine (PubChem CID 117330543) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(8-methylfuro[2,3-f][1]benzofuran-4-yl)propan-1-amine.
| Compound Name | 2-(8-methylfuro[2,3-f][1]benzofuran-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 117330543 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-(8-methylfuro[2,3-f][1]benzofuran-4-yl)propan-1-amine |
| SMILES | Cc1c2ccoc2c(C(C)CN)c2ccoc12 |
| InChI | InChI=1S/C14H15NO2/c1-8(7-15)12-11-4-6-16-13(11)9(2)10-3-5-17-14(10)12/h3-6,8H,7,15H2,1-2H3 |
| InChIKey | LDWIRUYPOJQDFC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |