C13H11ClO3 — CID 117380038
2-(4-chlorofuro[2,3-f][1]benzofuran-8-yl)propan-1-ol (PubChem CID 117380038) has the molecular formula C13H11ClO3 and a molecular weight of 250.68 g/mol. Its IUPAC name is 2-(4-chlorofuro[2,3-f][1]benzofuran-8-yl)propan-1-ol.
| Compound Name | 2-(4-chlorofuro[2,3-f][1]benzofuran-8-yl)propan-1-ol |
|---|---|
| PubChem CID | 117380038 |
| Molecular Formula | C13H11ClO3 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2-(4-chlorofuro[2,3-f][1]benzofuran-8-yl)propan-1-ol |
| SMILES | CC(CO)c1c2ccoc2c(Cl)c2ccoc12 |
| InChI | InChI=1S/C13H11ClO3/c1-7(6-15)10-8-2-4-17-13(8)11(14)9-3-5-16-12(9)10/h2-5,7,15H,6H2,1H3 |
| InChIKey | OOUGWZGSLYGGNH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |