C11H5ClO3 — CID 115010316
4-chlorofuro[2,3-f][1]benzofuran-8-carbaldehyde (PubChem CID 115010316) has the molecular formula C11H5ClO3 and a molecular weight of 220.61 g/mol. Its IUPAC name is 4-chlorofuro[2,3-f][1]benzofuran-8-carbaldehyde.
| Compound Name | 4-chlorofuro[2,3-f][1]benzofuran-8-carbaldehyde |
|---|---|
| PubChem CID | 115010316 |
| Molecular Formula | C11H5ClO3 |
| Molecular Weight | 220.61 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | 4-chlorofuro[2,3-f][1]benzofuran-8-carbaldehyde |
| SMILES | O=Cc1c2ccoc2c(Cl)c2ccoc12 |
| InChI | InChI=1S/C11H5ClO3/c12-9-7-2-4-14-10(7)8(5-13)6-1-3-15-11(6)9/h1-5H |
| InChIKey | DJNFULPWNPQUMB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|