C10H6O4 — CID 82374428
furo[2,3-g][1,3]benzodioxole-5-carbaldehyde (PubChem CID 82374428) has the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. Its IUPAC name is furo[2,3-g][1,3]benzodioxole-5-carbaldehyde.
| Compound Name | furo[2,3-g][1,3]benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 82374428 |
| Molecular Formula | C10H6O4 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | furo[2,3-g][1,3]benzodioxole-5-carbaldehyde |
| SMILES | O=Cc1cc2c(c3ccoc13)OCO2 |
| InChI | InChI=1S/C10H6O4/c11-4-6-3-8-10(14-5-13-8)7-1-2-12-9(6)7/h1-4H,5H2 |
| InChIKey | AGSPUQIIZDQPSH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|