C9H8O3 — CID 58304897
6-methyl-1,3-benzodioxole-4-carbaldehyde (PubChem CID 58304897) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 6-methyl-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 6-methyl-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 58304897 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 6-methyl-1,3-benzodioxole-4-carbaldehyde |
| SMILES | Cc1cc(C=O)c2c(c1)OCO2 |
| InChI | InChI=1S/C9H8O3/c1-6-2-7(4-10)9-8(3-6)11-5-12-9/h2-4H,5H2,1H3 |
| InChIKey | KQRDZDXYBFXMGV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|