C9H7ClO3 — CID 84668516
6-chloro-4-methyl-1,3-benzodioxole-5-carbaldehyde (PubChem CID 84668516) has the molecular formula C9H7ClO3 and a molecular weight of 198.60 g/mol. Its IUPAC name is 6-chloro-4-methyl-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 6-chloro-4-methyl-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 84668516 |
| Molecular Formula | C9H7ClO3 |
| Molecular Weight | 198.60 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 6-chloro-4-methyl-1,3-benzodioxole-5-carbaldehyde |
| SMILES | Cc1c(C=O)c(Cl)cc2c1OCO2 |
| InChI | InChI=1S/C9H7ClO3/c1-5-6(3-11)7(10)2-8-9(5)13-4-12-8/h2-3H,4H2,1H3 |
| InChIKey | NTTKUGCXRURBKR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.60 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|