C11H12ClNO3 — CID 117356137
7-(2-aminopropan-2-yl)-5-chloro-1,3-benzodioxole-4-carbaldehyde (PubChem CID 117356137) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is 7-(2-aminopropan-2-yl)-5-chloro-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 7-(2-aminopropan-2-yl)-5-chloro-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 117356137 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 7-(2-aminopropan-2-yl)-5-chloro-1,3-benzodioxole-4-carbaldehyde |
| SMILES | CC(C)(N)c1cc(Cl)c(C=O)c2c1OCO2 |
| InChI | InChI=1S/C11H12ClNO3/c1-11(2,13)7-3-8(12)6(4-14)9-10(7)16-5-15-9/h3-4H,5,13H2,1-2H3 |
| InChIKey | WPGXCYSCXUASTA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|