C11H12ClNO3 — CID 84702805
5-chloro-7-[2-(methylamino)ethyl]-1,3-benzodioxole-4-carbaldehyde (PubChem CID 84702805) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is 5-chloro-7-[2-(methylamino)ethyl]-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 5-chloro-7-[2-(methylamino)ethyl]-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 84702805 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 5-chloro-7-[2-(methylamino)ethyl]-1,3-benzodioxole-4-carbaldehyde |
| SMILES | CNCCc1cc(Cl)c(C=O)c2c1OCO2 |
| InChI | InChI=1S/C11H12ClNO3/c1-13-3-2-7-4-9(12)8(5-14)11-10(7)15-6-16-11/h4-5,13H,2-3,6H2,1H3 |
| InChIKey | NKRIHWIGTHZHIP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|