C13H17NO3 — CID 84698583
9-[2-(methylamino)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-6-carbaldehyde (PubChem CID 84698583) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 9-[2-(methylamino)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-6-carbaldehyde.
| Compound Name | 9-[2-(methylamino)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-6-carbaldehyde |
|---|---|
| PubChem CID | 84698583 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 9-[2-(methylamino)ethyl]-3,4-dihydro-2H-1,5-benzodioxepine-6-carbaldehyde |
| SMILES | CNCCc1ccc(C=O)c2c1OCCCO2 |
| InChI | InChI=1S/C13H17NO3/c1-14-6-5-10-3-4-11(9-15)13-12(10)16-7-2-8-17-13/h3-4,9,14H,2,5-8H2,1H3 |
| InChIKey | XTIQFBPBXMDJET-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|