C13H14ClNO3 — CID 117422858
5-chloro-7-(pyrrolidin-2-ylmethyl)-1,3-benzodioxole-4-carbaldehyde (PubChem CID 117422858) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is 5-chloro-7-(pyrrolidin-2-ylmethyl)-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 5-chloro-7-(pyrrolidin-2-ylmethyl)-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 117422858 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 5-chloro-7-(pyrrolidin-2-ylmethyl)-1,3-benzodioxole-4-carbaldehyde |
| SMILES | O=Cc1c(Cl)cc(CC2CCCN2)c2c1OCO2 |
| InChI | InChI=1S/C13H14ClNO3/c14-11-5-8(4-9-2-1-3-15-9)12-13(10(11)6-16)18-7-17-12/h5-6,9,15H,1-4,7H2 |
| InChIKey | AUXRPTFYBREXNQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|