C11H10ClNO4 — CID 117392013
6-chloro-7-[2-(methylamino)acetyl]-1,3-benzodioxole-4-carbaldehyde (PubChem CID 117392013) has the molecular formula C11H10ClNO4 and a molecular weight of 255.66 g/mol. Its IUPAC name is 6-chloro-7-[2-(methylamino)acetyl]-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 6-chloro-7-[2-(methylamino)acetyl]-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 117392013 |
| Molecular Formula | C11H10ClNO4 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 6-chloro-7-[2-(methylamino)acetyl]-1,3-benzodioxole-4-carbaldehyde |
| SMILES | CNCC(=O)c1c(Cl)cc(C=O)c2c1OCO2 |
| InChI | InChI=1S/C11H10ClNO4/c1-13-3-8(15)9-7(12)2-6(4-14)10-11(9)17-5-16-10/h2,4,13H,3,5H2,1H3 |
| InChIKey | RCBIOEAXKATBCT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|