C10H10ClNO3 — CID 84691416
7-(2-aminoethyl)-6-chloro-1,3-benzodioxole-4-carbaldehyde (PubChem CID 84691416) has the molecular formula C10H10ClNO3 and a molecular weight of 227.65 g/mol. Its IUPAC name is 7-(2-aminoethyl)-6-chloro-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 7-(2-aminoethyl)-6-chloro-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 84691416 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 7-(2-aminoethyl)-6-chloro-1,3-benzodioxole-4-carbaldehyde |
| SMILES | NCCc1c(Cl)cc(C=O)c2c1OCO2 |
| InChI | InChI=1S/C10H10ClNO3/c11-8-3-6(4-13)9-10(15-5-14-9)7(8)1-2-12/h3-4H,1-2,5,12H2 |
| InChIKey | YWKITTZJPHHVIP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|