C13H11ClO6 — CID 117481047
ethyl 2-(6-chloro-8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)-2-oxoacetate (PubChem CID 117481047) has the molecular formula C13H11ClO6 and a molecular weight of 298.68 g/mol. Its IUPAC name is ethyl 2-(6-chloro-8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(6-chloro-8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 117481047 |
| Molecular Formula | C13H11ClO6 |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | ethyl 2-(6-chloro-8-formyl-2,3-dihydro-1,4-benzodioxin-5-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1c(Cl)cc(C=O)c2c1OCCO2 |
| InChI | InChI=1S/C13H11ClO6/c1-2-18-13(17)10(16)9-8(14)5-7(6-15)11-12(9)20-4-3-19-11/h5-6H,2-4H2,1H3 |
| InChIKey | QOFTVURCZCEJNT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|