C11H8F2O4 — CID 117356921
ethyl 2-(4,5-difluoro-2-formylphenyl)-2-oxoacetate (PubChem CID 117356921) has the molecular formula C11H8F2O4 and a molecular weight of 242.18 g/mol. Its IUPAC name is ethyl 2-(4,5-difluoro-2-formylphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(4,5-difluoro-2-formylphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 117356921 |
| Molecular Formula | C11H8F2O4 |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | ethyl 2-(4,5-difluoro-2-formylphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(F)c(F)cc1C=O |
| InChI | InChI=1S/C11H8F2O4/c1-2-17-11(16)10(15)7-4-9(13)8(12)3-6(7)5-14/h3-5H,2H2,1H3 |
| InChIKey | AJJGYHOLLRQBEH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|