C10H8F2O4 — CID 117331870
ethyl 2-(3,5-difluoro-2-hydroxyphenyl)-2-oxoacetate (PubChem CID 117331870) has the molecular formula C10H8F2O4 and a molecular weight of 230.17 g/mol. Its IUPAC name is ethyl 2-(3,5-difluoro-2-hydroxyphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(3,5-difluoro-2-hydroxyphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 117331870 |
| Molecular Formula | C10H8F2O4 |
| Molecular Weight | 230.17 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | ethyl 2-(3,5-difluoro-2-hydroxyphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(F)cc(F)c1O |
| InChI | InChI=1S/C10H8F2O4/c1-2-16-10(15)9(14)6-3-5(11)4-7(12)8(6)13/h3-4,13H,2H2,1H3 |
| InChIKey | WPMNNXWSMGAIKU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|