C11H10F2O5S — CID 117471823
ethyl 2-(2,5-difluoro-3-methylsulfonylphenyl)-2-oxoacetate (PubChem CID 117471823) has the molecular formula C11H10F2O5S and a molecular weight of 292.26 g/mol. Its IUPAC name is ethyl 2-(2,5-difluoro-3-methylsulfonylphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(2,5-difluoro-3-methylsulfonylphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 117471823 |
| Molecular Formula | C11H10F2O5S |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | ethyl 2-(2,5-difluoro-3-methylsulfonylphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(F)cc(S(C)(=O)=O)c1F |
| InChI | InChI=1S/C11H10F2O5S/c1-3-18-11(15)10(14)7-4-6(12)5-8(9(7)13)19(2,16)17/h4-5H,3H2,1-2H3 |
| InChIKey | LXDHVDNJTZZYJE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|