C14H13F2NO6 — CID 57015316
diethyl 2-[(4,5-difluoro-2-nitrophenyl)methylidene]propanedioate (PubChem CID 57015316) has the molecular formula C14H13F2NO6 and a molecular weight of 329.26 g/mol. Its IUPAC name is diethyl 2-[(4,5-difluoro-2-nitrophenyl)methylidene]propanedioate.
| Compound Name | diethyl 2-[(4,5-difluoro-2-nitrophenyl)methylidene]propanedioate |
|---|---|
| PubChem CID | 57015316 |
| Molecular Formula | C14H13F2NO6 |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | diethyl 2-[(4,5-difluoro-2-nitrophenyl)methylidene]propanedioate |
| SMILES | CCOC(=O)C(=Cc1cc(F)c(F)cc1[N+](=O)[O-])C(=O)OCC |
| InChI | InChI=1S/C14H13F2NO6/c1-3-22-13(18)9(14(19)23-4-2)5-8-6-10(15)11(16)7-12(8)17(20)21/h5-7H,3-4H2,1-2H3 |
| InChIKey | PFOZALCTNQPCQK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|