About potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate
potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate (PubChem CID 159738810) has the molecular formula C15H15ClKNO9
and a molecular weight of 427.83 g/mol. Its IUPAC name is potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate.
Molecular Properties
| Compound Name | potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate |
| PubChem CID | 159738810 |
| Molecular Formula | C15H15ClKNO9 |
| Molecular Weight | 427.83 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate |
| SMILES | CCOC(=O)C(=Cc1ccc(Cl)cc1[N+](=O)[O-])C(=O)OCC.O=C([O-])O.[K+] |
| InChI | InChI=1S/C14H14ClNO6.CH2O3.K/c1-3-21-13(17)11(14(18)22-4-2)7-9-5-6-10(15)8-12(9)16(19)20;2-1(3)4;/h5-8H,3-4H2,1-2H3;(H2,2,3,4);/q;;+1/p-1 |
| InChIKey | NCEJGZQCOVKFCX-UHFFFAOYSA-M |
| XLogP | -1.35 |
| TPSA | 156.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.83 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate?
The IUPAC name of potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate (CID 159738810) is potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate.
What is the SMILES notation for potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate?
The canonical SMILES for potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate is CCOC(=O)C(=Cc1ccc(Cl)cc1[N+](=O)[O-])C(=O)OCC.O=C([O-])O.[K+].
What is the InChIKey of potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate?
The InChIKey is NCEJGZQCOVKFCX-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H14ClNO6.CH2O3.K/c1-3-21-13(17)11(14(18)22-4-2)7-9-5-6-10(15)8-12(9)16(19)20;2-1(3)4;/h5-8H,3-4H2,1-2H3;(H2,2,3,4);/q;;+1/p-1.
What are the key properties of potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate?
potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate has a molecular weight of 427.83 g/mol, XLogP of -1.35, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;diethyl 2-[(4-chloro-2-nitrophenyl)methylidene]propanedioate;hydrogen carbonate is sourced from PubChem (CID 159738810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).