About ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate
ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate (PubChem CID 154171081) has the molecular formula C11H10F3NO3
and a molecular weight of 261.20 g/mol. Its IUPAC name is ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate |
| PubChem CID | 154171081 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(N)=C(O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H10F3NO3/c1-2-18-11(17)9(15)10(16)5-3-7(13)8(14)4-6(5)12/h3-4,16H,2,15H2,1H3 |
| InChIKey | ABZCJQZXFPSKEU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate?
The IUPAC name of ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate (CID 154171081) is ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate.
What is the SMILES notation for ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate?
The canonical SMILES for ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate is CCOC(=O)C(N)=C(O)c1cc(F)c(F)cc1F.
What is the InChIKey of ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate?
The InChIKey is ABZCJQZXFPSKEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3NO3/c1-2-18-11(17)9(15)10(16)5-3-7(13)8(14)4-6(5)12/h3-4,16H,2,15H2,1H3.
What are the key properties of ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate?
ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate has a molecular weight of 261.20 g/mol, XLogP of 1.85, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate is sourced from PubChem (CID 154171081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).