C11H10F3NO3 — CID 154171081
ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate (PubChem CID 154171081) has the molecular formula C11H10F3NO3 and a molecular weight of 261.20 g/mol. Its IUPAC name is ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate.
| Compound Name | ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 154171081 |
| Molecular Formula | C11H10F3NO3 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | ethyl 2-amino-3-hydroxy-3-(2,4,5-trifluorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)C(N)=C(O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C11H10F3NO3/c1-2-18-11(17)9(15)10(16)5-3-7(13)8(14)4-6(5)12/h3-4,16H,2,15H2,1H3 |
| InChIKey | ABZCJQZXFPSKEU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|