C12H12F3NO2 — CID 141372335
ethyl 2-amino-4-(2,4,5-trifluorophenyl)but-2-enoate (PubChem CID 141372335) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is ethyl 2-amino-4-(2,4,5-trifluorophenyl)but-2-enoate.
| Compound Name | ethyl 2-amino-4-(2,4,5-trifluorophenyl)but-2-enoate |
|---|---|
| PubChem CID | 141372335 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | ethyl 2-amino-4-(2,4,5-trifluorophenyl)but-2-enoate |
| SMILES | CCOC(=O)C(N)=CCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H12F3NO2/c1-2-18-12(17)11(16)4-3-7-5-9(14)10(15)6-8(7)13/h4-6H,2-3,16H2,1H3 |
| InChIKey | RNLLTYIYFPXJPI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|