C13H11F3N2O3 — CID 166162134
ethyl 3-oxo-2-[(2,4,5-trifluorophenyl)methyl]-1H-pyrazole-5-carboxylate (PubChem CID 166162134) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is ethyl 3-oxo-2-[(2,4,5-trifluorophenyl)methyl]-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-oxo-2-[(2,4,5-trifluorophenyl)methyl]-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 166162134 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | ethyl 3-oxo-2-[(2,4,5-trifluorophenyl)methyl]-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(=O)n(Cc2cc(F)c(F)cc2F)[nH]1 |
| InChI | InChI=1S/C13H11F3N2O3/c1-2-21-13(20)11-5-12(19)18(17-11)6-7-3-9(15)10(16)4-8(7)14/h3-5,17H,2,6H2,1H3 |
| InChIKey | VMIKUZQTIMBPPI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|