C12H16F2N4O2 — CID 178059124
ethyl (E)-3-amino-2-(N,2-diamino-4,5-difluoroanilino)but-2-enoate (PubChem CID 178059124) has the molecular formula C12H16F2N4O2 and a molecular weight of 286.28 g/mol. Its IUPAC name is ethyl (E)-3-amino-2-(N,2-diamino-4,5-difluoroanilino)but-2-enoate.
| Compound Name | ethyl (E)-3-amino-2-(N,2-diamino-4,5-difluoroanilino)but-2-enoate |
|---|---|
| PubChem CID | 178059124 |
| Molecular Formula | C12H16F2N4O2 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | ethyl (E)-3-amino-2-(N,2-diamino-4,5-difluoroanilino)but-2-enoate |
| SMILES | CCOC(=O)/C(=C(/C)N)N(N)c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C12H16F2N4O2/c1-3-20-12(19)11(6(2)15)18(17)10-5-8(14)7(13)4-9(10)16/h4-5H,3,15-17H2,1-2H3/b11-6+ |
| InChIKey | JWJPGBPACPRJAJ-IZZDOVSWSA-N |
| XLogP | 0.98 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|