C20H20F2N4O3 — CID 178058778
ethyl (E)-3-amino-2-(N,2-diamino-4,5-difluoroanilino)-3-(7-methyl-1-benzofuran-5-yl)prop-2-enoate (PubChem CID 178058778) has the molecular formula C20H20F2N4O3 and a molecular weight of 402.40 g/mol. Its IUPAC name is ethyl (E)-3-amino-2-(N,2-diamino-4,5-difluoroanilino)-3-(7-methyl-1-benzofuran-5-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-amino-2-(N,2-diamino-4,5-difluoroanilino)-3-(7-methyl-1-benzofuran-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 178058778 |
| Molecular Formula | C20H20F2N4O3 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | ethyl (E)-3-amino-2-(N,2-diamino-4,5-difluoroanilino)-3-(7-methyl-1-benzofuran-5-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C(\N)c1cc(C)c2occc2c1)N(N)c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C20H20F2N4O3/c1-3-28-20(27)18(26(25)16-9-14(22)13(21)8-15(16)23)17(24)12-6-10(2)19-11(7-12)4-5-29-19/h4-9H,3,23-25H2,1-2H3/b18-17+ |
| InChIKey | VLCDHHWZIIZOFJ-ISLYRVAYSA-N |
| XLogP | 3.17 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|