ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate

C20H20O4 — CID 58820086

IUPACethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate
SMILESCCOC(=O)Cc1cc(Oc2cc(C)cc(C)c2)c2occc2c1
InChIInChI=1S/C20H20O4/c1-4-22-19(21)12-15-10-16-5-6-23-20(16)18(11-15)24-17-8-13(2)7-14(3)9-17/h5-11H,4,12H2,1-3H3
InChIKeyACTSCEVLOGXXBM-UHFFFAOYSA-N
MW324.38 g/mol
LogP4.95
Rot. Bonds5

About ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate

ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate (PubChem CID 58820086) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate.

Molecular Properties

Compound Nameethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate
PubChem CID58820086
Molecular FormulaC20H20O4
Molecular Weight324.38 g/mol
Exact Mass324.14
IUPAC Nameethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate
SMILESCCOC(=O)Cc1cc(Oc2cc(C)cc(C)c2)c2occc2c1
InChIInChI=1S/C20H20O4/c1-4-22-19(21)12-15-10-16-5-6-23-20(16)18(11-15)24-17-8-13(2)7-14(3)9-17/h5-11H,4,12H2,1-3H3
InChIKeyACTSCEVLOGXXBM-UHFFFAOYSA-N
XLogP4.95
TPSA48.67 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.38
LogP ≤ 54.95
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate?
The IUPAC name of ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate (CID 58820086) is ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate.
What is the SMILES notation for ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate?
The canonical SMILES for ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate is CCOC(=O)Cc1cc(Oc2cc(C)cc(C)c2)c2occc2c1.
What is the InChIKey of ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate?
The InChIKey is ACTSCEVLOGXXBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O4/c1-4-22-19(21)12-15-10-16-5-6-23-20(16)18(11-15)24-17-8-13(2)7-14(3)9-17/h5-11H,4,12H2,1-3H3.
What are the key properties of ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate?
ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate has a molecular weight of 324.38 g/mol, XLogP of 4.95, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[7-(3,5-dimethylphenoxy)-1-benzofuran-5-yl]acetate is sourced from PubChem (CID 58820086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).