C28H23N3O5 — CID 139560118
ethyl 2-[2-[[7-[5-(azidomethyl)-1-benzofuran-7-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 139560118) has the molecular formula C28H23N3O5 and a molecular weight of 481.51 g/mol. Its IUPAC name is ethyl 2-[2-[[7-[5-(azidomethyl)-1-benzofuran-7-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[7-[5-(azidomethyl)-1-benzofuran-7-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 139560118 |
| Molecular Formula | C28H23N3O5 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | ethyl 2-[2-[[7-[5-(azidomethyl)-1-benzofuran-7-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cc(-c2cc(CN=[N+]=[N-])cc3ccoc23)c2occc2c1 |
| InChI | InChI=1S/C28H23N3O5/c1-2-33-26(32)15-20-5-3-4-6-25(20)36-17-19-12-22-8-10-35-28(22)24(14-19)23-13-18(16-30-31-29)11-21-7-9-34-27(21)23/h3-14H,2,15-17H2,1H3 |
| InChIKey | KDAJWSDTEOANBC-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 110.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|