C28H32O4S — CID 156724849
ethane;ethyl 2-[2-[[7-(5-propylthiophen-3-yl)-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 156724849) has the molecular formula C28H32O4S and a molecular weight of 464.63 g/mol. Its IUPAC name is ethane;ethyl 2-[2-[[7-(5-propylthiophen-3-yl)-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethane;ethyl 2-[2-[[7-(5-propylthiophen-3-yl)-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 156724849 |
| Molecular Formula | C28H32O4S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | ethane;ethyl 2-[2-[[7-(5-propylthiophen-3-yl)-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CC.CCCc1cc(-c2cc(COc3ccccc3CC(=O)OCC)cc3ccoc23)cs1 |
| InChI | InChI=1S/C26H26O4S.C2H6/c1-3-7-22-14-21(17-31-22)23-13-18(12-20-10-11-29-26(20)23)16-30-24-9-6-5-8-19(24)15-25(27)28-4-2;1-2/h5-6,8-14,17H,3-4,7,15-16H2,1-2H3;1-2H3 |
| InChIKey | RHHTWXPEIOLAQW-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |