C27H27NO4 — CID 139560842
ethyl 2-[2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]-4-methylphenyl]acetate (PubChem CID 139560842) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is ethyl 2-[2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]-4-methylphenyl]acetate.
| Compound Name | ethyl 2-[2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]-4-methylphenyl]acetate |
|---|---|
| PubChem CID | 139560842 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | ethyl 2-[2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]-4-methylphenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C)cc1OCc1cc(-c2cccc(CN)c2)c2occc2c1 |
| InChI | InChI=1S/C27H27NO4/c1-3-30-26(29)15-22-8-7-18(2)11-25(22)32-17-20-13-23-9-10-31-27(23)24(14-20)21-6-4-5-19(12-21)16-28/h4-14H,3,15-17,28H2,1-2H3 |
| InChIKey | ZRNVEUDMECCOOA-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |