C28H27NO5 — CID 139560365
ethyl 2-[4-acetyl-2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 139560365) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is ethyl 2-[4-acetyl-2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[4-acetyl-2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 139560365 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | ethyl 2-[4-acetyl-2-[[7-[3-(aminomethyl)phenyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C(C)=O)cc1OCc1cc(-c2cccc(CN)c2)c2occc2c1 |
| InChI | InChI=1S/C28H27NO5/c1-3-32-27(31)15-23-8-7-21(18(2)30)14-26(23)34-17-20-12-24-9-10-33-28(24)25(13-20)22-6-4-5-19(11-22)16-29/h4-14H,3,15-17,29H2,1-2H3 |
| InChIKey | GOCCQZGRJKTGFD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |