C26H26N2O4 — CID 139560183
ethyl 2-[2-[[7-[6-(2-aminoethyl)-2-pyridinyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 139560183) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is ethyl 2-[2-[[7-[6-(2-aminoethyl)-2-pyridinyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | ethyl 2-[2-[[7-[6-(2-aminoethyl)-2-pyridinyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 139560183 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | ethyl 2-[2-[[7-[6-(2-aminoethyl)-2-pyridinyl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccccc1OCc1cc(-c2cccc(CCN)n2)c2occc2c1 |
| InChI | InChI=1S/C26H26N2O4/c1-2-30-25(29)16-19-6-3-4-9-24(19)32-17-18-14-20-11-13-31-26(20)22(15-18)23-8-5-7-21(28-23)10-12-27/h3-9,11,13-15H,2,10,12,16-17,27H2,1H3 |
| InChIKey | PUVSLTHUSWEJAV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |