C30H29NO6 — CID 166658063
3-methoxypropyl 2-[2-[[7-[5-(aminomethyl)-1-benzofuran-7-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 166658063) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is 3-methoxypropyl 2-[2-[[7-[5-(aminomethyl)-1-benzofuran-7-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | 3-methoxypropyl 2-[2-[[7-[5-(aminomethyl)-1-benzofuran-7-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 166658063 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 3-methoxypropyl 2-[2-[[7-[5-(aminomethyl)-1-benzofuran-7-yl]-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | COCCCOC(=O)Cc1ccccc1OCc1cc(-c2cc(CN)cc3ccoc23)c2occc2c1 |
| InChI | InChI=1S/C30H29NO6/c1-33-9-4-10-34-28(32)17-22-5-2-3-6-27(22)37-19-21-14-24-8-12-36-30(24)26(16-21)25-15-20(18-31)13-23-7-11-35-29(23)25/h2-3,5-8,11-16H,4,9-10,17-19,31H2,1H3 |
| InChIKey | LNSKQPBWBADUNI-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 97.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|