C28H27ClFNO5 — CID 146249506
3-methoxypropyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-2-chloro-1-benzofuran-6-yl]methoxy]phenyl]acetate (PubChem CID 146249506) has the molecular formula C28H27ClFNO5 and a molecular weight of 511.98 g/mol. Its IUPAC name is 3-methoxypropyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-2-chloro-1-benzofuran-6-yl]methoxy]phenyl]acetate.
| Compound Name | 3-methoxypropyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-2-chloro-1-benzofuran-6-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 146249506 |
| Molecular Formula | C28H27ClFNO5 |
| Molecular Weight | 511.98 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 3-methoxypropyl 2-[2-[[4-[3-(aminomethyl)-2-fluorophenyl]-2-chloro-1-benzofuran-6-yl]methoxy]phenyl]acetate |
| SMILES | COCCCOC(=O)Cc1ccccc1OCc1cc(-c2cccc(CN)c2F)c2cc(Cl)oc2c1 |
| InChI | InChI=1S/C28H27ClFNO5/c1-33-10-5-11-34-27(32)14-19-6-2-3-9-24(19)35-17-18-12-22(23-15-26(29)36-25(23)13-18)21-8-4-7-20(16-31)28(21)30/h2-4,6-9,12-13,15H,5,10-11,14,16-17,31H2,1H3 |
| InChIKey | OKXPIQMGNKZRTD-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.98 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|