About 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate
3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate (PubChem CID 58005998) has the molecular formula C16H24O5
and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate.
Molecular Properties
| Compound Name | 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate |
| PubChem CID | 58005998 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate |
| SMILES | COCCCOC(=O)Cc1ccccc1OCCCOC |
| InChI | InChI=1S/C16H24O5/c1-18-9-5-11-20-15-8-4-3-7-14(15)13-16(17)21-12-6-10-19-2/h3-4,7-8H,5-6,9-13H2,1-2H3 |
| InChIKey | SWRDZKAZVMCGJT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate?
The IUPAC name of 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate (CID 58005998) is 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate.
What is the SMILES notation for 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate?
The canonical SMILES for 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate is COCCCOC(=O)Cc1ccccc1OCCCOC.
What is the InChIKey of 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate?
The InChIKey is SWRDZKAZVMCGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O5/c1-18-9-5-11-20-15-8-4-3-7-14(15)13-16(17)21-12-6-10-19-2/h3-4,7-8H,5-6,9-13H2,1-2H3.
What are the key properties of 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate?
3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate has a molecular weight of 296.36 g/mol, XLogP of 2.22, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropyl 2-[2-(3-methoxypropoxy)phenyl]acetate is sourced from PubChem (CID 58005998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).