C24H24FN3O3 — CID 156570071
2-[2-[[3-amino-5-[3-(aminomethyl)-2-fluorophenyl]-4-(methyliminomethyl)phenyl]methoxy]phenyl]acetic acid (PubChem CID 156570071) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is 2-[2-[[3-amino-5-[3-(aminomethyl)-2-fluorophenyl]-4-(methyliminomethyl)phenyl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[3-amino-5-[3-(aminomethyl)-2-fluorophenyl]-4-(methyliminomethyl)phenyl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 156570071 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[2-[[3-amino-5-[3-(aminomethyl)-2-fluorophenyl]-4-(methyliminomethyl)phenyl]methoxy]phenyl]acetic acid |
| SMILES | C/N=C/c1c(N)cc(COc2ccccc2CC(=O)O)cc1-c1cccc(CN)c1F |
| InChI | InChI=1S/C24H24FN3O3/c1-28-13-20-19(18-7-4-6-17(12-26)24(18)25)9-15(10-21(20)27)14-31-22-8-3-2-5-16(22)11-23(29)30/h2-10,13H,11-12,14,26-27H2,1H3,(H,29,30)/b28-13+ |
| InChIKey | RNXZDXYYFQDLIV-XODNFHPESA-N |
| XLogP | 3.79 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|