C27H28FNO3 — CID 144778130
2-[2-[[3-[3-(aminomethyl)-2-fluorophenyl]-5-cyclopentylphenyl]methoxy]phenyl]acetic acid (PubChem CID 144778130) has the molecular formula C27H28FNO3 and a molecular weight of 433.52 g/mol. Its IUPAC name is 2-[2-[[3-[3-(aminomethyl)-2-fluorophenyl]-5-cyclopentylphenyl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[3-[3-(aminomethyl)-2-fluorophenyl]-5-cyclopentylphenyl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 144778130 |
| Molecular Formula | C27H28FNO3 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-[2-[[3-[3-(aminomethyl)-2-fluorophenyl]-5-cyclopentylphenyl]methoxy]phenyl]acetic acid |
| SMILES | NCc1cccc(-c2cc(COc3ccccc3CC(=O)O)cc(C3CCCC3)c2)c1F |
| InChI | InChI=1S/C27H28FNO3/c28-27-21(16-29)9-5-10-24(27)23-13-18(12-22(14-23)19-6-1-2-7-19)17-32-25-11-4-3-8-20(25)15-26(30)31/h3-5,8-14,19H,1-2,6-7,15-17,29H2,(H,30,31) |
| InChIKey | PUFVYOYMBPFTGR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |